Products 133001-07-7
CAS 133001-07-7 is the registry number for Indoxacarb Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (CAS 133001-07-7) is a chemical compound with the molecular formula C17H13ClFN3O and a molecular weight of 329.8 g/mol. IUPAC name: 4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole. InChIKey: QLCIKPCPKZMIAU-UHFFFAOYSA-N.
| Molecular formula | C17H13ClFN3O |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | 4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| InChIKey | QLCIKPCPKZMIAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2C(O2)(CN3C=NN=C3)C4=CC=C(C=C4)F)Cl |
Computed by PubChem (NCBI)