CAS 1330764-47-0 is the registry number for tert-Butyl 3-iodo-2-oxo-1,2,5,6,8,9-hexahydro-7H-pyrido[2,3-d]azepine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-iodo-2-oxo-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepine-7-carboxylate (CAS 1330764-47-0) is a chemical compound with the molecular formula C14H19IN2O3 and a molecular weight of 390.22 g/mol. IUPAC name: tert-butyl 3-iodo-2-oxo-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepine-7-carboxylate. InChIKey: NQPDSFBQDIFCKC-UHFFFAOYSA-N.
| Molecular formula | C14H19IN2O3 |
|---|---|
| Molecular weight | 390.22 g/mol |
| IUPAC name | tert-butyl 3-iodo-2-oxo-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepine-7-carboxylate |
| InChIKey | NQPDSFBQDIFCKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(CC1)NC(=O)C(=C2)I |
Computed by PubChem (NCBI)