Products 1334179-86-0
CAS 1334179-86-0 is the registry number for BTTES, 98.40%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 5 mg, 25 mg.
2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethyl hydrogen sulfate (CAS 1334179-86-0) is a chemical compound with the molecular formula C19H32N10O4S and a molecular weight of 496.6 g/mol. IUPAC name: 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethyl hydrogen sulfate. InChIKey: PDTNTHBFHAGNOC-UHFFFAOYSA-N.
| Molecular formula | C19H32N10O4S |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]ethyl hydrogen sulfate |
| InChIKey | PDTNTHBFHAGNOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(N=N1)CN(CC2=CN(N=N2)CCOS(=O)(=O)O)CC3=CN(N=N3)C(C)(C)C |
Computed by PubChem (NCBI)