Products 133525-05-0

CAS 133525-05-0 is the registry number for 2-Piperazinecarboxylic acid dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

Piperazine-2-carboxylic acid;dihydrochloride (CAS 133525-05-0) is a chemical compound with the molecular formula C5H12Cl2N2O2 and a molecular weight of 203.06 g/mol. IUPAC name: piperazine-2-carboxylic acid;dihydrochloride. InChIKey: WNSDZBQLMGKPQS-UHFFFAOYSA-N.

Identity
Molecular formulaC5H12Cl2N2O2
Molecular weight203.06 g/mol
IUPAC namepiperazine-2-carboxylic acid;dihydrochloride
InChIKeyWNSDZBQLMGKPQS-UHFFFAOYSA-N
SMILESC1CNC(CN1)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)