Products 1337707-64-8
CAS 1337707-64-8 is the registry number for 6-Iodo-1,2,3,4-tetrahydronaphthalen-1-amine. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
6-iodo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1337707-64-8) is a chemical compound with the molecular formula C10H12IN and a molecular weight of 273.11 g/mol. IUPAC name: 6-iodo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: AEVPYANNBCRPQN-UHFFFAOYSA-N.
| Molecular formula | C10H12IN |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | 6-iodo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | AEVPYANNBCRPQN-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)I)N |
Computed by PubChem (NCBI)