Products 1338083-52-5

CAS 1338083-52-5 is the registry number for 2-(4-(Methylsulfonyl)phenyl)-2-oxoethyl 2-(p-tolyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

[2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate (CAS 1338083-52-5) is a chemical compound with the molecular formula C18H18O5S and a molecular weight of 346.4 g/mol. IUPAC name: [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate. InChIKey: YZASVTXUQBFDPI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18O5S
Molecular weight346.4 g/mol
IUPAC name[2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate
InChIKeyYZASVTXUQBFDPI-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)CC(=O)OCC(=O)C2=CC=C(C=C2)S(=O)(=O)C

Computed by PubChem (NCBI)