CAS 1338083-52-5 is the registry number for 2-(4-(Methylsulfonyl)phenyl)-2-oxoethyl 2-(p-tolyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
[2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate (CAS 1338083-52-5) is a chemical compound with the molecular formula C18H18O5S and a molecular weight of 346.4 g/mol. IUPAC name: [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate. InChIKey: YZASVTXUQBFDPI-UHFFFAOYSA-N.
| Molecular formula | C18H18O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-methylphenyl)acetate |
| InChIKey | YZASVTXUQBFDPI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(=O)OCC(=O)C2=CC=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)