Products 134419-47-9
CAS 134419-47-9 is the registry number for 2-Hydroxy-5-iodo-3-methoxybenzoic acid, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-hydroxy-5-iodo-3-methoxybenzoic acid (CAS 134419-47-9) is a chemical compound with the molecular formula C8H7IO4 and a molecular weight of 294.04 g/mol. IUPAC name: 2-hydroxy-5-iodo-3-methoxybenzoic acid. InChIKey: CVPJHTGFRWRYOM-UHFFFAOYSA-N.
| Molecular formula | C8H7IO4 |
|---|---|
| Molecular weight | 294.04 g/mol |
| IUPAC name | 2-hydroxy-5-iodo-3-methoxybenzoic acid |
| InChIKey | CVPJHTGFRWRYOM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)C(=O)O)I |
Computed by PubChem (NCBI)