CAS 1344521-11-4 is the registry number for Methyl (s)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate (CAS 1344521-11-4) is a chemical compound with the molecular formula C12H14FNO2 and a molecular weight of 223.24 g/mol. IUPAC name: methyl (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate. InChIKey: PHLYYRVFFGPBHL-NSHDSACASA-N.
| Molecular formula | C12H14FNO2 |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | methyl (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| InChIKey | PHLYYRVFFGPBHL-NSHDSACASA-N |
| SMILES | COC(=O)C1=CC(=CC2=C1CCC[C@@H]2N)F |
Computed by PubChem (NCBI)