CAS 1344522-22-0 is the registry number for (S)-7-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-7-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1344522-22-0) is a chemical compound with the molecular formula C11H11ClF3N and a molecular weight of 249.66 g/mol. IUPAC name: (1S)-7-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: FFPBEWVAEJSPDE-JTQLQIEISA-N.
| Molecular formula | C11H11ClF3N |
|---|---|
| Molecular weight | 249.66 g/mol |
| IUPAC name | (1S)-7-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | FFPBEWVAEJSPDE-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C(=CC(=C2)Cl)C(F)(F)F)N |
Computed by PubChem (NCBI)