CAS 1346599-04-9 appears in our catalog under these names: Malathion β-Monoacid-d5, Malathion beta-Monoacid-d5. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-dimethoxyphosphinothioylsulfanyl-4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)butanoic acid (CAS 1346599-04-9) is a chemical compound with the molecular formula C8H15O6PS2 and a molecular weight of 307.3 g/mol. IUPAC name: 3-dimethoxyphosphinothioylsulfanyl-4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)butanoic acid. InChIKey: FARGSBYVTRDSKX-SGEUAGPISA-N.
| Molecular formula | C8H15O6PS2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 3-dimethoxyphosphinothioylsulfanyl-4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)butanoic acid |
| InChIKey | FARGSBYVTRDSKX-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C(CC(=O)O)SP(=S)(OC)OC |
Computed by PubChem (NCBI)