CAS 1346605-10-4 appears in our catalog under these names: AM-2201-d4, AM–2201–d4. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 10mg.
Naphthalen-1-yl-[1-(1,1,5,5-tetradeuterio-5-fluoropentyl)indol-3-yl]methanone (CAS 1346605-10-4) is a chemical compound with the molecular formula C24H22FNO and a molecular weight of 363.5 g/mol. IUPAC name: naphthalen-1-yl-[1-(1,1,5,5-tetradeuterio-5-fluoropentyl)indol-3-yl]methanone. InChIKey: ALQFAGFPQCBPED-ONNKGWAKSA-N.
| Molecular formula | C24H22FNO |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | naphthalen-1-yl-[1-(1,1,5,5-tetradeuterio-5-fluoropentyl)indol-3-yl]methanone |
| InChIKey | ALQFAGFPQCBPED-ONNKGWAKSA-N |
| SMILES | [2H]C([2H])(CCCC([2H])([2H])F)N1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)