Products 1349717-76-5
CAS 1349717-76-5 is the registry number for 1,4-Dibromo-2,6-diisopropylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2,5-dibromo-1,3-di(propan-2-yl)benzene (CAS 1349717-76-5) is a chemical compound with the molecular formula C12H16Br2 and a molecular weight of 320.06 g/mol. IUPAC name: 2,5-dibromo-1,3-di(propan-2-yl)benzene. InChIKey: WKGQNYMQIYJEDX-UHFFFAOYSA-N.
| Molecular formula | C12H16Br2 |
|---|---|
| Molecular weight | 320.06 g/mol |
| IUPAC name | 2,5-dibromo-1,3-di(propan-2-yl)benzene |
| InChIKey | WKGQNYMQIYJEDX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1Br)C(C)C)Br |
Computed by PubChem (NCBI)