CAS 1350557-24-2 appears in our catalog under these names: (SP-4-1)-[5,15-Diphenyl-21H,23H-porphinato(2-)-κN21,κN22,κN23,κN24]iron, 97%, 97%, (SP-4-1)-[5,15-Diphenyl-21H,23H-porphinato(2-)-κN21,κN22,κN23,κN24]iron, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5,15-diphenylporphyrin-22,24-diide;iron(2+) (CAS 1350557-24-2) is a chemical compound with the molecular formula C32H20FeN4 and a molecular weight of 516.4 g/mol. IUPAC name: 5,15-diphenylporphyrin-22,24-diide;iron(2+). InChIKey: XDBKRUAANNGFRW-UHFFFAOYSA-N.
| Molecular formula | C32H20FeN4 |
|---|---|
| Molecular weight | 516.4 g/mol |
| IUPAC name | 5,15-diphenylporphyrin-22,24-diide;iron(2+) |
| InChIKey | XDBKRUAANNGFRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=CC4=NC(=C(C5=CC=C([N-]5)C=C6C=CC2=N6)C7=CC=CC=C7)C=C4)[N-]3.[Fe+2] |
Computed by PubChem (NCBI)