Products 1350558-27-8
CAS 1350558-27-8 is the registry number for N-(4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1350558-27-8) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: QYIIYMIQIGRJNC-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | QYIIYMIQIGRJNC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)C)F |
Computed by PubChem (NCBI)