CAS 1351344-18-7 is the registry number for rel-tert-Butyl ((3R,4S)-1-benzyl-4-(2-fluoro-5-methylphenyl)pyrrolidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3R,4S)-1-benzyl-4-(2-fluoro-5-methylphenyl)pyrrolidin-3-yl]carbamate (CAS 1351344-18-7) is a chemical compound with the molecular formula C23H29FN2O2 and a molecular weight of 384.5 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-1-benzyl-4-(2-fluoro-5-methylphenyl)pyrrolidin-3-yl]carbamate. InChIKey: PHZJCHGTKNYSST-CTNGQTDRSA-N.
| Molecular formula | C23H29FN2O2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-1-benzyl-4-(2-fluoro-5-methylphenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | PHZJCHGTKNYSST-CTNGQTDRSA-N |
| SMILES | CC1=CC(=C(C=C1)F)[C@H]2CN(C[C@@H]2NC(=O)OC(C)(C)C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)