Products 1352062-19-1
CAS 1352062-19-1 appears in our catalog under these names: Peramivir Impurity 25, Peramivir Impurity 7 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid;hydrochloride (CAS 1352062-19-1) is a chemical compound with the molecular formula C14H27ClN2O4 and a molecular weight of 322.83 g/mol. IUPAC name: (1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid;hydrochloride. InChIKey: WSJKPJHRMRJYME-BMIRNUAISA-N.
| Molecular formula | C14H27ClN2O4 |
|---|---|
| Molecular weight | 322.83 g/mol |
| IUPAC name | (1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | WSJKPJHRMRJYME-BMIRNUAISA-N |
| SMILES | CCC(CC)[C@@H]([C@H]1[C@@H](C[C@@H]([C@H]1O)C(=O)O)N)NC(=O)C.Cl |
Computed by PubChem (NCBI)