CAS 135656-94-9 is the registry number for Indoxacarb Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-4-oxido-1,2,4-triazol-4-ium (CAS 135656-94-9) is a chemical compound with the molecular formula C17H13ClFN3O2 and a molecular weight of 345.8 g/mol. IUPAC name: 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-4-oxido-1,2,4-triazol-4-ium. InChIKey: HOPGQOZTYXYOHK-UHFFFAOYSA-N.
| Molecular formula | C17H13ClFN3O2 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-4-oxido-1,2,4-triazol-4-ium |
| InChIKey | HOPGQOZTYXYOHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2C(O2)(CN3C=[N+](C=N3)[O-])C4=CC=C(C=C4)F)Cl |
Computed by PubChem (NCBI)