CAS 1357073-39-2 is the registry number for rel-tert-Butyl (3R,4S)-3-amino-4-(3-fluoro-2-methylphenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-amino-4-(3-fluoro-2-methylphenyl)pyrrolidine-1-carboxylate (CAS 1357073-39-2) is a chemical compound with the molecular formula C16H23FN2O2 and a molecular weight of 294.36 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-(3-fluoro-2-methylphenyl)pyrrolidine-1-carboxylate. InChIKey: JBKMLZSBFBKZTQ-OCCSQVGLSA-N.
| Molecular formula | C16H23FN2O2 |
|---|---|
| Molecular weight | 294.36 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-(3-fluoro-2-methylphenyl)pyrrolidine-1-carboxylate |
| InChIKey | JBKMLZSBFBKZTQ-OCCSQVGLSA-N |
| SMILES | CC1=C(C=CC=C1F)[C@H]2CN(C[C@@H]2N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)