Products 1357073-47-2
CAS 1357073-47-2 is the registry number for rel-tert-Butyl (3S,4R)-3-amino-4-(3-chloro-2-fluorophenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S,4R)-3-amino-4-(3-chloro-2-fluorophenyl)pyrrolidine-1-carboxylate (CAS 1357073-47-2) is a chemical compound with the molecular formula C15H20ClFN2O2 and a molecular weight of 314.78 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-(3-chloro-2-fluorophenyl)pyrrolidine-1-carboxylate. InChIKey: WAHLHFBXRKQRBJ-CMPLNLGQSA-N.
| Molecular formula | C15H20ClFN2O2 |
|---|---|
| Molecular weight | 314.78 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-(3-chloro-2-fluorophenyl)pyrrolidine-1-carboxylate |
| InChIKey | WAHLHFBXRKQRBJ-CMPLNLGQSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)N)C2=C(C(=CC=C2)Cl)F |
Computed by PubChem (NCBI)