CAS 1357287-50-3 is the registry number for 2-Hydroxy-3-(tritylthio)propanoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
2-hydroxy-3-tritylsulfanylpropanoic acid (CAS 1357287-50-3) is a chemical compound with the molecular formula C22H20O3S and a molecular weight of 364.5 g/mol. IUPAC name: 2-hydroxy-3-tritylsulfanylpropanoic acid. InChIKey: QFDZZZLJDKSWSE-UHFFFAOYSA-N.
| Molecular formula | C22H20O3S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 2-hydroxy-3-tritylsulfanylpropanoic acid |
| InChIKey | QFDZZZLJDKSWSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC(C(=O)O)O |
Computed by PubChem (NCBI)