Products 1357354-28-9
CAS 1357354-28-9 is the registry number for Racemic-(3as,3br,6ar,7as)-2-tert-butyl 6a-methyl octahydro-1h-cyclopenta[1,2-c:3,4-c']dipyrrole-2,6a(3bh)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-O-tert-butyl 8-O-methyl (1R,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate (CAS 1357354-28-9) is a chemical compound with the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. IUPAC name: 4-O-tert-butyl 8-O-methyl (1R,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate. InChIKey: KEPLUTFWEJFEIK-JBBSTSQOSA-N.
| Molecular formula | C16H26N2O4 |
|---|---|
| Molecular weight | 310.39 g/mol |
| IUPAC name | 4-O-tert-butyl 8-O-methyl (1R,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate |
| InChIKey | KEPLUTFWEJFEIK-JBBSTSQOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@]3(CNC[C@@H]3[C@H]2C1)C(=O)OC |
Computed by PubChem (NCBI)