Products 135820-01-8

CAS 135820-01-8 is the registry number for Ferulic Acid Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,2-dicarboxylic acid (CAS 135820-01-8) is a chemical compound with the molecular formula C20H20O8 and a molecular weight of 388.4 g/mol. IUPAC name: 3,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,2-dicarboxylic acid. InChIKey: QGKVAHVDILSDDX-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20O8
Molecular weight388.4 g/mol
IUPAC name3,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,2-dicarboxylic acid
InChIKeyQGKVAHVDILSDDX-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C2C(C(C2C(=O)O)C(=O)O)C3=CC(=C(C=C3)O)OC)O

Computed by PubChem (NCBI)