Products 13584-65-1

CAS 13584-65-1 is the registry number for Benzo[b]thiophen-2-amine hydrochloride, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-benzothiophen-2-amine;hydrochloride (CAS 13584-65-1) is a chemical compound with the molecular formula C8H8ClNS and a molecular weight of 185.67 g/mol. IUPAC name: 1-benzothiophen-2-amine;hydrochloride. InChIKey: XPPUOZUUOFQHKD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNS
Molecular weight185.67 g/mol
IUPAC name1-benzothiophen-2-amine;hydrochloride
InChIKeyXPPUOZUUOFQHKD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(S2)N.Cl

Computed by PubChem (NCBI)