CAS 13584-65-1 is the registry number for Benzo[b]thiophen-2-amine hydrochloride, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-benzothiophen-2-amine;hydrochloride (CAS 13584-65-1) is a chemical compound with the molecular formula C8H8ClNS and a molecular weight of 185.67 g/mol. IUPAC name: 1-benzothiophen-2-amine;hydrochloride. InChIKey: XPPUOZUUOFQHKD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNS |
|---|---|
| Molecular weight | 185.67 g/mol |
| IUPAC name | 1-benzothiophen-2-amine;hydrochloride |
| InChIKey | XPPUOZUUOFQHKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)N.Cl |
Computed by PubChem (NCBI)