CAS 135973-06-7 is the registry number for Chloro[(1,2,5,6-η)-1,5-cyclooctadiene][2-(diphenylphosphino-κP)pyridine]rhodium, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Cycloocta-1,5-diene;diphenyl(pyridin-2-yl)phosphanium;rhodium (CAS 135973-06-7) is a chemical compound with the molecular formula C25H27NPRh+ and a molecular weight of 475.4 g/mol. IUPAC name: cycloocta-1,5-diene;diphenyl(pyridin-2-yl)phosphanium;rhodium. InChIKey: YYIOYKIXPKCRGN-UHFFFAOYSA-O.
| Molecular formula | C25H27NPRh+ |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | cycloocta-1,5-diene;diphenyl(pyridin-2-yl)phosphanium;rhodium |
| InChIKey | YYIOYKIXPKCRGN-UHFFFAOYSA-O |
| SMILES | C1CC=CCCC=C1.C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=N3.[Rh] |
Computed by PubChem (NCBI)