CAS 1361681-64-2 is the registry number for 4-Bromo-2-chloro-5-(trifluoromethoxy)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2-chloro-5-(trifluoromethoxy)pyridine (CAS 1361681-64-2) is a chemical compound with the molecular formula C6H2BrClF3NO and a molecular weight of 276.44 g/mol. IUPAC name: 4-bromo-2-chloro-5-(trifluoromethoxy)pyridine. InChIKey: IOKJABUEPUCKDS-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3NO |
|---|---|
| Molecular weight | 276.44 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-(trifluoromethoxy)pyridine |
| InChIKey | IOKJABUEPUCKDS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)OC(F)(F)F)Br |
Computed by PubChem (NCBI)