CAS 136554-96-6 is the registry number for (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-sulfopropanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 500mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid (CAS 136554-96-6) is a chemical compound with the molecular formula C18H17NO7S and a molecular weight of 391.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid. InChIKey: BUTKUPGRCQCTTA-MRXNPFEDSA-N.
| Molecular formula | C18H17NO7S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid |
| InChIKey | BUTKUPGRCQCTTA-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)