CAS 136790-79-9 is the registry number for Lubiprostone Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (E)-7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (CAS 136790-79-9) is a chemical compound with the molecular formula C27H36F2O5 and a molecular weight of 478.6 g/mol. IUPAC name: benzyl (E)-7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate. InChIKey: RWVCDFLDUAIJOY-LOYPZAONSA-N.
| Molecular formula | C27H36F2O5 |
|---|---|
| Molecular weight | 478.6 g/mol |
| IUPAC name | benzyl (E)-7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| InChIKey | RWVCDFLDUAIJOY-LOYPZAONSA-N |
| SMILES | CCCCC(C(=O)CC[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C/CCCC(=O)OCC2=CC=CC=C2)O)(F)F |
Computed by PubChem (NCBI)