Products 1368621-98-0
CAS 1368621-98-0 appears in our catalog under these names: 2-[4-(2,3-dimethylphenoxy)phenyl]acetic acid, 97%, 97%, 2-[4-(2,3-dimethylphenoxy)phenyl]acetic acid, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-[4-(2,3-dimethylphenoxy)phenyl]acetic acid (CAS 1368621-98-0) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-[4-(2,3-dimethylphenoxy)phenyl]acetic acid. InChIKey: NCMDOKJJMNYTOR-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-[4-(2,3-dimethylphenoxy)phenyl]acetic acid |
| InChIKey | NCMDOKJJMNYTOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC2=CC=C(C=C2)CC(=O)O)C |
Computed by PubChem (NCBI)