Products 1369914-13-5
CAS 1369914-13-5 is the registry number for 3-chloro-5-fluoro-N,N-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-5-fluoro-N,N-dimethylbenzamide (CAS 1369914-13-5) is a chemical compound with the molecular formula C9H9ClFNO and a molecular weight of 201.62 g/mol. IUPAC name: 3-chloro-5-fluoro-N,N-dimethylbenzamide. InChIKey: WKFGAWYPVHSXPG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO |
|---|---|
| Molecular weight | 201.62 g/mol |
| IUPAC name | 3-chloro-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | WKFGAWYPVHSXPG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Cl)F |
Computed by PubChem (NCBI)