CAS 1372452-73-7 is the registry number for (4R)-3,4-dihydro-1H-2-benzopyran-4-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(4R)-3,4-dihydro-1H-isochromen-4-ol (CAS 1372452-73-7) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 150.17 g/mol. IUPAC name: (4R)-3,4-dihydro-1H-isochromen-4-ol. InChIKey: IXFIRBDJVKBOFO-VIFPVBQESA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 150.17 g/mol |
| IUPAC name | (4R)-3,4-dihydro-1H-isochromen-4-ol |
| InChIKey | IXFIRBDJVKBOFO-VIFPVBQESA-N |
| SMILES | C1[C@@H](C2=CC=CC=C2CO1)O |
Computed by PubChem (NCBI)