Products 1380411-57-3
CAS 1380411-57-3 is the registry number for FC11409B. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenyl] sulfamate tetrafluoroborate (CAS 1380411-57-3) is a chemical compound with the molecular formula C29H23BF4N2O3S and a molecular weight of 566.4 g/mol. IUPAC name: [4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenyl] sulfamate tetrafluoroborate. InChIKey: ODRMDUOSDISTHM-UHFFFAOYSA-N.
| Molecular formula | C29H23BF4N2O3S |
|---|---|
| Molecular weight | 566.4 g/mol |
| IUPAC name | [4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenyl] sulfamate tetrafluoroborate |
| InChIKey | ODRMDUOSDISTHM-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)C2=CC(=[N+](C(=C2)C3=CC=CC=C3)C4=CC=C(C=C4)OS(=O)(=O)N)C5=CC=CC=C5 |
Computed by PubChem (NCBI)