Products 1381948-96-4
CAS 1381948-96-4 is the registry number for 4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)thiazole, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole (CAS 1381948-96-4) is a chemical compound with the molecular formula C15H18BNO2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole. InChIKey: OXPICRFSISNJHJ-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole |
| InChIKey | OXPICRFSISNJHJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CSC=N3 |
Computed by PubChem (NCBI)