Products 1383531-51-8

CAS 1383531-51-8 is the registry number for (2'-Chloro-[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[4-(2-chlorophenyl)phenyl]boronic acid (CAS 1383531-51-8) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: [4-(2-chlorophenyl)phenyl]boronic acid. InChIKey: IWDJHXRBAXJKAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BClO2
Molecular weight232.47 g/mol
IUPAC name[4-(2-chlorophenyl)phenyl]boronic acid
InChIKeyIWDJHXRBAXJKAJ-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC=CC=C2Cl)(O)O

Computed by PubChem (NCBI)