CAS 1383578-03-7 is the registry number for 4,8-Dihydroxynaphthalene-2,6-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,8-dihydroxynaphthalene-2,6-dicarboxylic acid (CAS 1383578-03-7) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 4,8-dihydroxynaphthalene-2,6-dicarboxylic acid. InChIKey: POXYDFYKMVBSTR-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 4,8-dihydroxynaphthalene-2,6-dicarboxylic acid |
| InChIKey | POXYDFYKMVBSTR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CC(=C2)C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)