Products 1383578-03-7

CAS 1383578-03-7 is the registry number for 4,8-Dihydroxynaphthalene-2,6-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

4,8-dihydroxynaphthalene-2,6-dicarboxylic acid (CAS 1383578-03-7) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 4,8-dihydroxynaphthalene-2,6-dicarboxylic acid. InChIKey: POXYDFYKMVBSTR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8O6
Molecular weight248.19 g/mol
IUPAC name4,8-dihydroxynaphthalene-2,6-dicarboxylic acid
InChIKeyPOXYDFYKMVBSTR-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1C(=CC(=C2)C(=O)O)O)O)C(=O)O

Computed by PubChem (NCBI)