Products 1384170-58-4
CAS 1384170-58-4 appears in our catalog under these names: SP–6–27, SP-6-27. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 100mg, 50mg, Get quote.
2-amino-7-(dimethylamino)-4-[4-(dimethylamino)naphthalen-1-yl]-4H-chromene-3-carbonitrile (CAS 1384170-58-4) is a chemical compound with the molecular formula C24H24N4O and a molecular weight of 384.5 g/mol. IUPAC name: 2-amino-7-(dimethylamino)-4-[4-(dimethylamino)naphthalen-1-yl]-4H-chromene-3-carbonitrile. InChIKey: XWCSZMDVKNZVMD-UHFFFAOYSA-N.
| Molecular formula | C24H24N4O |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2-amino-7-(dimethylamino)-4-[4-(dimethylamino)naphthalen-1-yl]-4H-chromene-3-carbonitrile |
| InChIKey | XWCSZMDVKNZVMD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(C(=C(O2)N)C#N)C3=CC=C(C4=CC=CC=C34)N(C)C |
Computed by PubChem (NCBI)