Products 1388026-00-3
CAS 1388026-00-3 is the registry number for 8-Methyl-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-methyl-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1388026-00-3) is a chemical compound with the molecular formula C11H12F3N and a molecular weight of 215.21 g/mol. IUPAC name: 8-methyl-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: NSOPIBNDHYEMBI-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 8-methyl-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | NSOPIBNDHYEMBI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C(F)(F)F)CCCN2 |
Computed by PubChem (NCBI)