CAS 138890-58-1 is the registry number for Brinzolamide Impurity 10. Offered by: TRC. Available pack sizes: 50mg.
(4R)-4-(ethylamino)-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (CAS 138890-58-1) is a chemical compound with the molecular formula C9H15N3O4S3 and a molecular weight of 325.4 g/mol. IUPAC name: (4R)-4-(ethylamino)-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide. InChIKey: GJDXMGTZKOMXRY-ZETCQYMHSA-N.
| Molecular formula | C9H15N3O4S3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4R)-4-(ethylamino)-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| InChIKey | GJDXMGTZKOMXRY-ZETCQYMHSA-N |
| SMILES | CCN[C@H]1CN(S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)