Products 138951-54-9
CAS 138951-54-9 is the registry number for FK 584. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S)-N-tert-butyl-4,4-diphenylcyclopent-2-en-1-amine (CAS 138951-54-9) is a chemical compound with the molecular formula C21H25N and a molecular weight of 291.4 g/mol. IUPAC name: (1S)-N-tert-butyl-4,4-diphenylcyclopent-2-en-1-amine. InChIKey: QMTVTICJRCJOFZ-LJQANCHMSA-N.
| Molecular formula | C21H25N |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | (1S)-N-tert-butyl-4,4-diphenylcyclopent-2-en-1-amine |
| InChIKey | QMTVTICJRCJOFZ-LJQANCHMSA-N |
| SMILES | CC(C)(C)N[C@H]1CC(C=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)