CAS 1390654-17-7 is the registry number for 5-Chloro-1H-1,2,4-triazole-3-carboxylic acid N,N-diethylethanamine salt, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-1H-1,2,4-triazole-3-carboxylic acid;N,N-diethylethanamine (CAS 1390654-17-7) is a chemical compound with the molecular formula C9H17ClN4O2 and a molecular weight of 248.71 g/mol. IUPAC name: 5-chloro-1H-1,2,4-triazole-3-carboxylic acid;N,N-diethylethanamine. InChIKey: PDWDMQKCPIIRNC-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN4O2 |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | 5-chloro-1H-1,2,4-triazole-3-carboxylic acid;N,N-diethylethanamine |
| InChIKey | PDWDMQKCPIIRNC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.C1(=NNC(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)