CAS 1391731-47-7 is the registry number for tert-Butyl (3aR,7aR)-octahydrospiro[indole-3,3'-piperidine]-1'-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aR,7aR)-spiro[1,2,3a,4,5,6,7,7a-octahydroindole-3,3'-piperidine]-1'-carboxylate (CAS 1391731-47-7) is a chemical compound with the molecular formula C17H30N2O2 and a molecular weight of 294.4 g/mol. IUPAC name: tert-butyl (3aR,7aR)-spiro[1,2,3a,4,5,6,7,7a-octahydroindole-3,3'-piperidine]-1'-carboxylate. InChIKey: FNSZQFZQISBTBY-RFOFMGPBSA-N.
| Molecular formula | C17H30N2O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | tert-butyl (3aR,7aR)-spiro[1,2,3a,4,5,6,7,7a-octahydroindole-3,3'-piperidine]-1'-carboxylate |
| InChIKey | FNSZQFZQISBTBY-RFOFMGPBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CN[C@H]3[C@@H]2CCCC3 |
Computed by PubChem (NCBI)