CAS 1391759-99-1 is the registry number for 2,4,6-Tris[3-(1H-imidazol-1-yl)phenyl]-1,3,5-triazine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tris(3-imidazol-1-ylphenyl)-1,3,5-triazine (CAS 1391759-99-1) is a chemical compound with the molecular formula C30H21N9 and a molecular weight of 507.5 g/mol. IUPAC name: 2,4,6-tris(3-imidazol-1-ylphenyl)-1,3,5-triazine. InChIKey: DCKGITJJUTWZEG-UHFFFAOYSA-N.
| Molecular formula | C30H21N9 |
|---|---|
| Molecular weight | 507.5 g/mol |
| IUPAC name | 2,4,6-tris(3-imidazol-1-ylphenyl)-1,3,5-triazine |
| InChIKey | DCKGITJJUTWZEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CN=C2)C3=NC(=NC(=N3)C4=CC(=CC=C4)N5C=CN=C5)C6=CC(=CC=C6)N7C=CN=C7 |
Computed by PubChem (NCBI)