Products 1391911-53-7

CAS 1391911-53-7 is the registry number for ETHYL 3-PENTYLOCTANOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-pentyloctanoate (CAS 1391911-53-7) is a chemical compound with the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. IUPAC name: ethyl 3-pentyloctanoate. InChIKey: WKOLMZJPJFTUSC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H30O2
Molecular weight242.40 g/mol
IUPAC nameethyl 3-pentyloctanoate
InChIKeyWKOLMZJPJFTUSC-UHFFFAOYSA-N
SMILESCCCCCC(CCCCC)CC(=O)OCC

Computed by PubChem (NCBI)