CAS 139487-11-9 is the registry number for 5-Iodo-1,3,3-trimethyl-2-oxoindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-iodo-1,3,3-trimethylindol-2-one (CAS 139487-11-9) is a chemical compound with the molecular formula C11H12INO and a molecular weight of 301.12 g/mol. IUPAC name: 5-iodo-1,3,3-trimethylindol-2-one. InChIKey: UFBOVBLVFIDZRX-UHFFFAOYSA-N.
| Molecular formula | C11H12INO |
|---|---|
| Molecular weight | 301.12 g/mol |
| IUPAC name | 5-iodo-1,3,3-trimethylindol-2-one |
| InChIKey | UFBOVBLVFIDZRX-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)I)N(C1=O)C)C |
Computed by PubChem (NCBI)