Products 139681-18-8
CAS 139681-18-8 is the registry number for SDZ-FOX-988. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-methoxycarbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate (CAS 139681-18-8) is a chemical compound with the molecular formula C25H29NO5 and a molecular weight of 423.5 g/mol. IUPAC name: [(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-methoxycarbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate. InChIKey: YXIAKADBIZQTQI-ROMGYVFFSA-N.
| Molecular formula | C25H29NO5 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | [(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-methoxycarbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate |
| InChIKey | YXIAKADBIZQTQI-ROMGYVFFSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)/C(=N/OC)/OC(=O)C2=CC=C(C=C2)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)