Products 1397264-17-3
CAS 1397264-17-3 is the registry number for 5'-(4-Carboxy-3-methoxyphenyl)-3,3''-dimethoxy-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3,5-bis(4-carboxy-3-methoxyphenyl)phenyl]-2-methoxybenzoic acid (CAS 1397264-17-3) is a chemical compound with the molecular formula C30H24O9 and a molecular weight of 528.5 g/mol. IUPAC name: 4-[3,5-bis(4-carboxy-3-methoxyphenyl)phenyl]-2-methoxybenzoic acid. InChIKey: XLMNJTUQNSATEJ-UHFFFAOYSA-N.
| Molecular formula | C30H24O9 |
|---|---|
| Molecular weight | 528.5 g/mol |
| IUPAC name | 4-[3,5-bis(4-carboxy-3-methoxyphenyl)phenyl]-2-methoxybenzoic acid |
| InChIKey | XLMNJTUQNSATEJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=CC(=C2)C3=CC(=C(C=C3)C(=O)O)OC)C4=CC(=C(C=C4)C(=O)O)OC)C(=O)O |
Computed by PubChem (NCBI)