CAS 1400808-31-2 is the registry number for Reaxys ID:22916422. Offered by: GLPBio. Available pack sizes: 200mg.
Tert-butyl N-[6-fluoro-2,4-bis(sulfanylidene)-1,9-dihydropyrimido[4,5-b]indol-8-yl]-N-methylcarbamate (CAS 1400808-31-2) is a chemical compound with the molecular formula C16H17FN4O2S2 and a molecular weight of 380.5 g/mol. IUPAC name: tert-butyl N-[6-fluoro-2,4-bis(sulfanylidene)-1,9-dihydropyrimido[4,5-b]indol-8-yl]-N-methylcarbamate. InChIKey: CZHYSDMEYFVHCS-UHFFFAOYSA-N.
| Molecular formula | C16H17FN4O2S2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | tert-butyl N-[6-fluoro-2,4-bis(sulfanylidene)-1,9-dihydropyrimido[4,5-b]indol-8-yl]-N-methylcarbamate |
| InChIKey | CZHYSDMEYFVHCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=CC2=C1NC3=C2C(=S)NC(=S)N3)F |
Computed by PubChem (NCBI)