Products 1401351-59-4
CAS 1401351-59-4 is the registry number for N-([1,1'-Biphenyl]-2-yl)-[1,1':4',1''-terphenyl]-4-amine, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
2-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline (CAS 1401351-59-4) is a chemical compound with the molecular formula C30H23N and a molecular weight of 397.5 g/mol. IUPAC name: 2-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline. InChIKey: ZZHLMZTUBCZMAS-UHFFFAOYSA-N.
| Molecular formula | C30H23N |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 2-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline |
| InChIKey | ZZHLMZTUBCZMAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC=C4C5=CC=CC=C5 |
Computed by PubChem (NCBI)