CAS 1401661-94-6 is the registry number for Valganciclovir Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-2-hydroxypropyl] (2S)-2-amino-3-methylbutanoate (CAS 1401661-94-6) is a chemical compound with the molecular formula C14H22N6O5 and a molecular weight of 354.36 g/mol. IUPAC name: [(2S)-3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-2-hydroxypropyl] (2S)-2-amino-3-methylbutanoate. InChIKey: RNBGQKJHNTUYCU-IUCAKERBSA-N.
| Molecular formula | C14H22N6O5 |
|---|---|
| Molecular weight | 354.36 g/mol |
| IUPAC name | [(2S)-3-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-2-hydroxypropyl] (2S)-2-amino-3-methylbutanoate |
| InChIKey | RNBGQKJHNTUYCU-IUCAKERBSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC[C@H](COCN1C=NC2=C1N=C(NC2=O)N)O)N |
Computed by PubChem (NCBI)