CAS 14050-29-4 is the registry number for [[4,4'-[(1-Methyl-1,2-ethanediyl)di(nitrilo-κN)]bis[2-pentanonato-κO]](2-)]copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper;4-[2-(4-oxopentan-2-ylideneamino)propylimino]pentan-2-one (CAS 14050-29-4) is a chemical compound with the molecular formula C13H22CuN2O2 and a molecular weight of 301.87 g/mol. IUPAC name: copper;4-[2-(4-oxopentan-2-ylideneamino)propylimino]pentan-2-one. InChIKey: HKQGLMHJLFHQRJ-UHFFFAOYSA-N.
| Molecular formula | C13H22CuN2O2 |
|---|---|
| Molecular weight | 301.87 g/mol |
| IUPAC name | copper;4-[2-(4-oxopentan-2-ylideneamino)propylimino]pentan-2-one |
| InChIKey | HKQGLMHJLFHQRJ-UHFFFAOYSA-N |
| SMILES | CC(CN=C(C)CC(=O)C)N=C(C)CC(=O)C.[Cu] |
Computed by PubChem (NCBI)