Products 140923-25-7
CAS 140923-25-7 is the registry number for Iprovalicarb. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl N-[3-methyl-1-[[(1S)-1-(4-methylphenyl)ethyl]amino]-1-oxobutan-2-yl]carbamate (CAS 140923-25-7) is a chemical compound with the molecular formula C18H28N2O3 and a molecular weight of 320.4 g/mol. IUPAC name: propan-2-yl N-[3-methyl-1-[[(1S)-1-(4-methylphenyl)ethyl]amino]-1-oxobutan-2-yl]carbamate. InChIKey: NWUWYYSKZYIQAE-LBAUFKAWSA-N.
| Molecular formula | C18H28N2O3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | propan-2-yl N-[3-methyl-1-[[(1S)-1-(4-methylphenyl)ethyl]amino]-1-oxobutan-2-yl]carbamate |
| InChIKey | NWUWYYSKZYIQAE-LBAUFKAWSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C)NC(=O)C(C(C)C)NC(=O)OC(C)C |
Computed by PubChem (NCBI)